About 2-[4-(3,6-diphenylcarbazol-9-yl)phenyl]-5-phenyl-1,3,4-oxadiazole
2-[4-(3,6-diphenylcarbazol-9-yl)phenyl]-5-phenyl-1,3,4-oxadiazole (PubChem CID 58281802) has the molecular formula C38H25N3O
and a molecular weight of 539.64 g/mol. Its IUPAC name is 2-[4-(3,6-diphenylcarbazol-9-yl)phenyl]-5-phenyl-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2-[4-(3,6-diphenylcarbazol-9-yl)phenyl]-5-phenyl-1,3,4-oxadiazole |
| PubChem CID | 58281802 |
| Molecular Formula | C38H25N3O |
| Molecular Weight | 539.64 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | 2-[4-(3,6-diphenylcarbazol-9-yl)phenyl]-5-phenyl-1,3,4-oxadiazole |
| SMILES | c1ccc(-c2ccc3c(c2)c2cc(-c4ccccc4)ccc2n3-c2ccc(-c3nnc(-c4ccccc4)o3)cc2)cc1 |
| InChI | InChI=1S/C38H25N3O/c1-4-10-26(11-5-1)30-18-22-35-33(24-30)34-25-31(27-12-6-2-7-13-27)19-23-36(34)41(35)32-20-16-29(17-21-32)38-40-39-37(42-38)28-14-8-3-9-15-28/h1-25H |
| InChIKey | ZNETWGJOLKACPS-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 539.64 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(3,6-diphenylcarbazol-9-yl)phenyl]-5-phenyl-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3,6-diphenylcarbazol-9-yl)phenyl]-5-phenyl-1,3,4-oxadiazole?
The IUPAC name of 2-[4-(3,6-diphenylcarbazol-9-yl)phenyl]-5-phenyl-1,3,4-oxadiazole (CID 58281802) is 2-[4-(3,6-diphenylcarbazol-9-yl)phenyl]-5-phenyl-1,3,4-oxadiazole.
What is the SMILES notation for 2-[4-(3,6-diphenylcarbazol-9-yl)phenyl]-5-phenyl-1,3,4-oxadiazole?
The canonical SMILES for 2-[4-(3,6-diphenylcarbazol-9-yl)phenyl]-5-phenyl-1,3,4-oxadiazole is c1ccc(-c2ccc3c(c2)c2cc(-c4ccccc4)ccc2n3-c2ccc(-c3nnc(-c4ccccc4)o3)cc2)cc1.
What is the InChIKey of 2-[4-(3,6-diphenylcarbazol-9-yl)phenyl]-5-phenyl-1,3,4-oxadiazole?
The InChIKey is ZNETWGJOLKACPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H25N3O/c1-4-10-26(11-5-1)30-18-22-35-33(24-30)34-25-31(27-12-6-2-7-13-27)19-23-36(34)41(35)32-20-16-29(17-21-32)38-40-39-37(42-38)28-14-8-3-9-15-28/h1-25H.
What are the key properties of 2-[4-(3,6-diphenylcarbazol-9-yl)phenyl]-5-phenyl-1,3,4-oxadiazole?
2-[4-(3,6-diphenylcarbazol-9-yl)phenyl]-5-phenyl-1,3,4-oxadiazole has a molecular weight of 539.64 g/mol, XLogP of 9.83, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3,6-diphenylcarbazol-9-yl)phenyl]-5-phenyl-1,3,4-oxadiazole is sourced from PubChem (CID 58281802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).