C48H32N2S5 — CID 58281853
4,7-bis[5-(5-methyl-3-phenylthiophen-2-yl)-3-phenylthiophen-2-yl]-2,1,3-benzothiadiazole (PubChem CID 58281853) has the molecular formula C48H32N2S5 and a molecular weight of 797.13 g/mol. Its IUPAC name is 4,7-bis[5-(5-methyl-3-phenylthiophen-2-yl)-3-phenylthiophen-2-yl]-2,1,3-benzothiadiazole.
| Compound Name | 4,7-bis[5-(5-methyl-3-phenylthiophen-2-yl)-3-phenylthiophen-2-yl]-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 58281853 |
| Molecular Formula | C48H32N2S5 |
| Molecular Weight | 797.13 g/mol |
| Exact Mass | 796.12 |
| IUPAC Name | 4,7-bis[5-(5-methyl-3-phenylthiophen-2-yl)-3-phenylthiophen-2-yl]-2,1,3-benzothiadiazole |
| SMILES | Cc1cc(-c2ccccc2)c(-c2cc(-c3ccccc3)c(-c3ccc(-c4sc(-c5sc(C)cc5-c5ccccc5)cc4-c4ccccc4)c4nsnc34)s2)s1 |
| InChI | InChI=1S/C48H32N2S5/c1-29-25-37(31-15-7-3-8-16-31)47(51-29)41-27-39(33-19-11-5-12-20-33)45(53-41)35-23-24-36(44-43(35)49-55-50-44)46-40(34-21-13-6-14-22-34)28-42(54-46)48-38(26-30(2)52-48)32-17-9-4-10-18-32/h3-28H,1-2H3 |
| InChIKey | BVEZIVMXIFOULI-UHFFFAOYSA-N |
| XLogP | 15.89 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.13 |
| LogP ≤ 5 | 15.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |