C38H34Br2 — CID 58282031
2,7-dibromo-9-[3-[(5E)-octa-5,7-dienyl]phenyl]-9-[3-[(2E)-penta-2,4-dienyl]phenyl]fluorene (PubChem CID 58282031) has the molecular formula C38H34Br2 and a molecular weight of 650.50 g/mol. Its IUPAC name is 2,7-dibromo-9-[3-[(5E)-octa-5,7-dienyl]phenyl]-9-[3-[(2E)-penta-2,4-dienyl]phenyl]fluorene.
| Compound Name | 2,7-dibromo-9-[3-[(5E)-octa-5,7-dienyl]phenyl]-9-[3-[(2E)-penta-2,4-dienyl]phenyl]fluorene |
|---|---|
| PubChem CID | 58282031 |
| Molecular Formula | C38H34Br2 |
| Molecular Weight | 650.50 g/mol |
| Exact Mass | 648.10 |
| IUPAC Name | 2,7-dibromo-9-[3-[(5E)-octa-5,7-dienyl]phenyl]-9-[3-[(2E)-penta-2,4-dienyl]phenyl]fluorene |
| SMILES | C=C/C=C/CCCCc1cccc(C2(c3cccc(C/C=C/C=C)c3)c3cc(Br)ccc3-c3ccc(Br)cc32)c1 |
| InChI | InChI=1S/C38H34Br2/c1-3-5-7-8-9-11-15-29-17-13-19-31(25-29)38(30-18-12-16-28(24-30)14-10-6-4-2)36-26-32(39)20-22-34(36)35-23-21-33(40)27-37(35)38/h3-7,10,12-13,16-27H,1-2,8-9,11,14-15H2/b7-5+,10-6+ |
| InChIKey | FSRWBOTUVGPDPT-YLNKAEQOSA-N |
| XLogP | 11.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.50 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|