C25H21F2NO — CID 58282046
9-[4-[(2Z)-3,4-difluoropenta-2,4-dienoxy]phenyl]-3,6-dimethylcarbazole (PubChem CID 58282046) has the molecular formula C25H21F2NO and a molecular weight of 389.45 g/mol. Its IUPAC name is 9-[4-[(2Z)-3,4-difluoropenta-2,4-dienoxy]phenyl]-3,6-dimethylcarbazole.
| Compound Name | 9-[4-[(2Z)-3,4-difluoropenta-2,4-dienoxy]phenyl]-3,6-dimethylcarbazole |
|---|---|
| PubChem CID | 58282046 |
| Molecular Formula | C25H21F2NO |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 9-[4-[(2Z)-3,4-difluoropenta-2,4-dienoxy]phenyl]-3,6-dimethylcarbazole |
| SMILES | C=C(F)/C(F)=C/COc1ccc(-n2c3ccc(C)cc3c3cc(C)ccc32)cc1 |
| InChI | InChI=1S/C25H21F2NO/c1-16-4-10-24-21(14-16)22-15-17(2)5-11-25(22)28(24)19-6-8-20(9-7-19)29-13-12-23(27)18(3)26/h4-12,14-15H,3,13H2,1-2H3/b23-12- |
| InChIKey | QFYLFBRRPMSHEH-FMCGGJTJSA-N |
| XLogP | 7.12 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|