C18H22O2 — CID 58282064
1,4-dimethyl-2,5-bis[(2E)-penta-2,4-dienoxy]benzene (PubChem CID 58282064) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is 1,4-dimethyl-2,5-bis[(2E)-penta-2,4-dienoxy]benzene.
| Compound Name | 1,4-dimethyl-2,5-bis[(2E)-penta-2,4-dienoxy]benzene |
|---|---|
| PubChem CID | 58282064 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 1,4-dimethyl-2,5-bis[(2E)-penta-2,4-dienoxy]benzene |
| SMILES | C=C/C=C/COc1cc(C)c(OC/C=C/C=C)cc1C |
| InChI | InChI=1S/C18H22O2/c1-5-7-9-11-19-17-13-16(4)18(14-15(17)3)20-12-10-8-6-2/h5-10,13-14H,1-2,11-12H2,3-4H3/b9-7+,10-8+ |
| InChIKey | GTCVUVRBJQAKNH-FIFLTTCUSA-N |
| XLogP | 4.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|