C36H36F4N2O15S — CID 58282153
1-O-[2,5-dimethyl-5-(2-methylpropanoyloxy)hexan-2-yl] 4-O-[1,3,5,7-tetraoxo-2-[2,3,5,6-tetrafluoro-4-(2-methylpropanoyloxy)phenyl]sulfonyloxypyrrolo[3,4-f]isoindol-6-yl] butanedioate (PubChem CID 58282153) has the molecular formula C36H36F4N2O15S and a molecular weight of 844.74 g/mol. Its IUPAC name is 1-O-[2,5-dimethyl-5-(2-methylpropanoyloxy)hexan-2-yl] 4-O-[1,3,5,7-tetraoxo-2-[2,3,5,6-tetrafluoro-4-(2-methylpropanoyloxy)phenyl]sulfonyloxypyrrolo[3,4-f]isoindol-6-yl] butanedioate.
| Compound Name | 1-O-[2,5-dimethyl-5-(2-methylpropanoyloxy)hexan-2-yl] 4-O-[1,3,5,7-tetraoxo-2-[2,3,5,6-tetrafluoro-4-(2-methylpropanoyloxy)phenyl]sulfonyloxypyrrolo[3,4-f]isoindol-6-yl] butanedioate |
|---|---|
| PubChem CID | 58282153 |
| Molecular Formula | C36H36F4N2O15S |
| Molecular Weight | 844.74 g/mol |
| Exact Mass | 844.18 |
| IUPAC Name | 1-O-[2,5-dimethyl-5-(2-methylpropanoyloxy)hexan-2-yl] 4-O-[1,3,5,7-tetraoxo-2-[2,3,5,6-tetrafluoro-4-(2-methylpropanoyloxy)phenyl]sulfonyloxypyrrolo[3,4-f]isoindol-6-yl] butanedioate |
| SMILES | CC(C)C(=O)Oc1c(F)c(F)c(S(=O)(=O)On2c(=O)c3cc4c(=O)n(OC(=O)CCC(=O)OC(C)(C)CCC(C)(C)OC(=O)C(C)C)c(=O)c4cc3c2=O)c(F)c1F |
| InChI | InChI=1S/C36H36F4N2O15S/c1-15(2)33(49)53-27-23(37)25(39)28(26(40)24(27)38)58(51,52)57-42-31(47)19-13-17-18(14-20(19)32(42)48)30(46)41(29(17)45)56-22(44)10-9-21(43)54-35(5,6)11-12-36(7,8)55-34(50)16(3)4/h13-16H,9-12H2,1-8H3 |
| InChIKey | PZZTUXFGWILDSX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 226.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.74 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|