C16H4F4N2O9S — CID 58282154
(6-hydroxy-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl) 2,3,5,6-tetrafluoro-4-hydroxybenzenesulfonate (PubChem CID 58282154) has the molecular formula C16H4F4N2O9S and a molecular weight of 476.27 g/mol. Its IUPAC name is (6-hydroxy-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl) 2,3,5,6-tetrafluoro-4-hydroxybenzenesulfonate.
| Compound Name | (6-hydroxy-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl) 2,3,5,6-tetrafluoro-4-hydroxybenzenesulfonate |
|---|---|
| PubChem CID | 58282154 |
| Molecular Formula | C16H4F4N2O9S |
| Molecular Weight | 476.27 g/mol |
| Exact Mass | 475.96 |
| IUPAC Name | (6-hydroxy-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl) 2,3,5,6-tetrafluoro-4-hydroxybenzenesulfonate |
| SMILES | O=c1c2cc3c(=O)n(OS(=O)(=O)c4c(F)c(F)c(O)c(F)c4F)c(=O)c3cc2c(=O)n1O |
| InChI | InChI=1S/C16H4F4N2O9S/c17-7-9(19)12(10(20)8(18)11(7)23)32(29,30)31-22-15(26)5-1-3-4(2-6(5)16(22)27)14(25)21(28)13(3)24/h1-2,23,28H |
| InChIKey | AYMSLTWEGVBKCI-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 161.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.27 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|