C17H8F4N2O9S — CID 58282177
(13-hydroxy-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl) 1,1,2,2-tetrafluoro-3-hydroxypropane-1-sulfonate (PubChem CID 58282177) has the molecular formula C17H8F4N2O9S and a molecular weight of 492.32 g/mol. Its IUPAC name is (13-hydroxy-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl) 1,1,2,2-tetrafluoro-3-hydroxypropane-1-sulfonate.
| Compound Name | (13-hydroxy-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl) 1,1,2,2-tetrafluoro-3-hydroxypropane-1-sulfonate |
|---|---|
| PubChem CID | 58282177 |
| Molecular Formula | C17H8F4N2O9S |
| Molecular Weight | 492.32 g/mol |
| Exact Mass | 491.99 |
| IUPAC Name | (13-hydroxy-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl) 1,1,2,2-tetrafluoro-3-hydroxypropane-1-sulfonate |
| SMILES | O=C1c2ccc3c4c(ccc(c24)C(=O)N1O)C(=O)N(OS(=O)(=O)C(F)(F)C(F)(F)CO)C3=O |
| InChI | InChI=1S/C17H8F4N2O9S/c18-16(19,5-24)17(20,21)33(30,31)32-23-14(27)8-3-1-6-10-7(13(26)22(29)12(6)25)2-4-9(11(8)10)15(23)28/h1-4,24,29H,5H2 |
| InChIKey | CRVZQCJTLVNYRI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 158.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.32 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|