C25H13ClF4N2O13S — CID 58282184
[2-[4-(4-chloro-4-oxobutanoyl)oxy-2,3,5,6-tetrafluorophenyl]sulfonyloxy-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl] 4-oxopentanoate (PubChem CID 58282184) has the molecular formula C25H13ClF4N2O13S and a molecular weight of 692.89 g/mol. Its IUPAC name is [2-[4-(4-chloro-4-oxobutanoyl)oxy-2,3,5,6-tetrafluorophenyl]sulfonyloxy-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl] 4-oxopentanoate.
| Compound Name | [2-[4-(4-chloro-4-oxobutanoyl)oxy-2,3,5,6-tetrafluorophenyl]sulfonyloxy-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl] 4-oxopentanoate |
|---|---|
| PubChem CID | 58282184 |
| Molecular Formula | C25H13ClF4N2O13S |
| Molecular Weight | 692.89 g/mol |
| Exact Mass | 691.98 |
| IUPAC Name | [2-[4-(4-chloro-4-oxobutanoyl)oxy-2,3,5,6-tetrafluorophenyl]sulfonyloxy-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl] 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)On1c(=O)c2cc3c(=O)n(OS(=O)(=O)c4c(F)c(F)c(OC(=O)CCC(=O)Cl)c(F)c4F)c(=O)c3cc2c1=O |
| InChI | InChI=1S/C25H13ClF4N2O13S/c1-8(33)2-4-15(36)44-31-22(37)9-6-11-12(7-10(9)23(31)38)25(40)32(24(11)39)45-46(41,42)21-18(29)16(27)20(17(28)19(21)30)43-14(35)5-3-13(26)34/h6-7H,2-5H2,1H3 |
| InChIKey | KXYIRXKXETZCCN-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 208.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.89 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|