C6H2F10O — CID 582822
2,2,3,3,4,4,5,5,6,6-decafluorohexanal (PubChem CID 582822) has the molecular formula C6H2F10O and a molecular weight of 280.06 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decafluorohexanal.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decafluorohexanal |
|---|---|
| PubChem CID | 582822 |
| Molecular Formula | C6H2F10O |
| Molecular Weight | 280.06 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decafluorohexanal |
| SMILES | O=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C6H2F10O/c7-2(8)4(11,12)6(15,16)5(13,14)3(9,10)1-17/h1-2H |
| InChIKey | AMLSPSUVDSSZTR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.06 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|