C34H34O10 — CID 58282495
[4-[4-[2-(hydroxymethyl)-4,5-dimethoxybenzoyl]oxyphenyl]-3,5-dimethylphenyl] 2,4,5-tris(hydroxymethyl)benzoate (PubChem CID 58282495) has the molecular formula C34H34O10 and a molecular weight of 602.64 g/mol. Its IUPAC name is [4-[4-[2-(hydroxymethyl)-4,5-dimethoxybenzoyl]oxyphenyl]-3,5-dimethylphenyl] 2,4,5-tris(hydroxymethyl)benzoate.
| Compound Name | [4-[4-[2-(hydroxymethyl)-4,5-dimethoxybenzoyl]oxyphenyl]-3,5-dimethylphenyl] 2,4,5-tris(hydroxymethyl)benzoate |
|---|---|
| PubChem CID | 58282495 |
| Molecular Formula | C34H34O10 |
| Molecular Weight | 602.64 g/mol |
| Exact Mass | 602.22 |
| IUPAC Name | [4-[4-[2-(hydroxymethyl)-4,5-dimethoxybenzoyl]oxyphenyl]-3,5-dimethylphenyl] 2,4,5-tris(hydroxymethyl)benzoate |
| SMILES | COc1cc(CO)c(C(=O)Oc2ccc(-c3c(C)cc(OC(=O)c4cc(CO)c(CO)cc4CO)cc3C)cc2)cc1OC |
| InChI | InChI=1S/C34H34O10/c1-19-9-27(44-33(39)28-12-23(16-36)22(15-35)11-24(28)17-37)10-20(2)32(19)21-5-7-26(8-6-21)43-34(40)29-14-31(42-4)30(41-3)13-25(29)18-38/h5-14,35-38H,15-18H2,1-4H3 |
| InChIKey | MCFSNWGGYHNAHH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.64 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|