C17H26O2 — CID 58282919
(6E,10Z,12E,14E)-2-hydroxy-2-methylhexadeca-6,10,12,14-tetraen-5-one (PubChem CID 58282919) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is (6E,10Z,12E,14E)-2-hydroxy-2-methylhexadeca-6,10,12,14-tetraen-5-one.
| Compound Name | (6E,10Z,12E,14E)-2-hydroxy-2-methylhexadeca-6,10,12,14-tetraen-5-one |
|---|---|
| PubChem CID | 58282919 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | (6E,10Z,12E,14E)-2-hydroxy-2-methylhexadeca-6,10,12,14-tetraen-5-one |
| SMILES | C/C=C/C=C/C=C\CC/C=C/C(=O)CCC(C)(C)O |
| InChI | InChI=1S/C17H26O2/c1-4-5-6-7-8-9-10-11-12-13-16(18)14-15-17(2,3)19/h4-9,12-13,19H,10-11,14-15H2,1-3H3/b5-4+,7-6+,9-8-,13-12+ |
| InChIKey | BSPIGHIAMGQXFI-UEOYEZOQSA-N |
| XLogP | 4.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|