C27H53F3O5Si2 — CID 58282925
1-O-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl] 6-O-(4,4,4-trifluorobutyl) 5-ethyl-2,2,4,4-tetramethylhexanedioate (PubChem CID 58282925) has the molecular formula C27H53F3O5Si2 and a molecular weight of 570.88 g/mol. Its IUPAC name is 1-O-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl] 6-O-(4,4,4-trifluorobutyl) 5-ethyl-2,2,4,4-tetramethylhexanedioate.
| Compound Name | 1-O-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl] 6-O-(4,4,4-trifluorobutyl) 5-ethyl-2,2,4,4-tetramethylhexanedioate |
|---|---|
| PubChem CID | 58282925 |
| Molecular Formula | C27H53F3O5Si2 |
| Molecular Weight | 570.88 g/mol |
| Exact Mass | 570.34 |
| IUPAC Name | 1-O-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl] 6-O-(4,4,4-trifluorobutyl) 5-ethyl-2,2,4,4-tetramethylhexanedioate |
| SMILES | CCCC[Si](C)(C)O[Si](C)(C)CCCOC(=O)C(C)(C)CC(C)(C)C(CC)C(=O)OCCCC(F)(F)F |
| InChI | InChI=1S/C27H53F3O5Si2/c1-11-13-19-36(7,8)35-37(9,10)20-15-18-34-24(32)26(5,6)21-25(3,4)22(12-2)23(31)33-17-14-16-27(28,29)30/h22H,11-21H2,1-10H3 |
| InChIKey | BXRLEGCDDLWHCX-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.88 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|