C23H48O5Si2 — CID 58282926
6-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propoxy]-2-ethyl-3,3,5,5-tetramethyl-6-oxohexanoic acid (PubChem CID 58282926) has the molecular formula C23H48O5Si2 and a molecular weight of 460.80 g/mol. Its IUPAC name is 6-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propoxy]-2-ethyl-3,3,5,5-tetramethyl-6-oxohexanoic acid.
| Compound Name | 6-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propoxy]-2-ethyl-3,3,5,5-tetramethyl-6-oxohexanoic acid |
|---|---|
| PubChem CID | 58282926 |
| Molecular Formula | C23H48O5Si2 |
| Molecular Weight | 460.80 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | 6-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propoxy]-2-ethyl-3,3,5,5-tetramethyl-6-oxohexanoic acid |
| SMILES | CCCC[Si](C)(C)O[Si](C)(C)CCCOC(=O)C(C)(C)CC(C)(C)C(CC)C(=O)O |
| InChI | InChI=1S/C23H48O5Si2/c1-11-13-16-29(7,8)28-30(9,10)17-14-15-27-21(26)23(5,6)18-22(3,4)19(12-2)20(24)25/h19H,11-18H2,1-10H3,(H,24,25) |
| InChIKey | HBTCNGMBASTJKP-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.80 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|