About (2-propan-2-yl-2-adamantyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate
(2-propan-2-yl-2-adamantyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate (PubChem CID 58283223) has the molecular formula C21H35NO5S
and a molecular weight of 413.58 g/mol. Its IUPAC name is (2-propan-2-yl-2-adamantyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate.
Molecular Properties
| Compound Name | (2-propan-2-yl-2-adamantyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate |
| PubChem CID | 58283223 |
| Molecular Formula | C21H35NO5S |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | (2-propan-2-yl-2-adamantyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate |
| SMILES | CC(C)C1(OC(=O)COCCN2CCS(=O)(=O)CC2)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C21H35NO5S/c1-15(2)21(18-10-16-9-17(12-18)13-19(21)11-16)27-20(23)14-26-6-3-22-4-7-28(24,25)8-5-22/h15-19H,3-14H2,1-2H3 |
| InChIKey | RBCOLTBVXPMGKH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2-propan-2-yl-2-adamantyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-propan-2-yl-2-adamantyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate?
The IUPAC name of (2-propan-2-yl-2-adamantyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate (CID 58283223) is (2-propan-2-yl-2-adamantyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate.
What is the SMILES notation for (2-propan-2-yl-2-adamantyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate?
The canonical SMILES for (2-propan-2-yl-2-adamantyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate is CC(C)C1(OC(=O)COCCN2CCS(=O)(=O)CC2)C2CC3CC(C2)CC1C3.
What is the InChIKey of (2-propan-2-yl-2-adamantyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate?
The InChIKey is RBCOLTBVXPMGKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H35NO5S/c1-15(2)21(18-10-16-9-17(12-18)13-19(21)11-16)27-20(23)14-26-6-3-22-4-7-28(24,25)8-5-22/h15-19H,3-14H2,1-2H3.
What are the key properties of (2-propan-2-yl-2-adamantyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate?
(2-propan-2-yl-2-adamantyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate has a molecular weight of 413.58 g/mol, XLogP of 2.13, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-propan-2-yl-2-adamantyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate is sourced from PubChem (CID 58283223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).