C17H25NO4S — CID 58283233
8-tricyclo[5.2.1.02,6]dec-4-enyl 3-(1,1-dioxo-1,4-thiazinan-4-yl)propanoate (PubChem CID 58283233) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is 8-tricyclo[5.2.1.02,6]dec-4-enyl 3-(1,1-dioxo-1,4-thiazinan-4-yl)propanoate.
| Compound Name | 8-tricyclo[5.2.1.02,6]dec-4-enyl 3-(1,1-dioxo-1,4-thiazinan-4-yl)propanoate |
|---|---|
| PubChem CID | 58283233 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 8-tricyclo[5.2.1.02,6]dec-4-enyl 3-(1,1-dioxo-1,4-thiazinan-4-yl)propanoate |
| SMILES | O=C(CCN1CCS(=O)(=O)CC1)OC1CC2CC1C1C=CCC21 |
| InChI | InChI=1S/C17H25NO4S/c19-17(4-5-18-6-8-23(20,21)9-7-18)22-16-11-12-10-15(16)14-3-1-2-13(12)14/h1,3,12-16H,2,4-11H2 |
| InChIKey | PKCGIEZFWGASPQ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|