About (1-methylcyclohexyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate
(1-methylcyclohexyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate (PubChem CID 58283248) has the molecular formula C15H27NO5S
and a molecular weight of 333.45 g/mol. Its IUPAC name is (1-methylcyclohexyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate.
Molecular Properties
| Compound Name | (1-methylcyclohexyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate |
| PubChem CID | 58283248 |
| Molecular Formula | C15H27NO5S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (1-methylcyclohexyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate |
| SMILES | CC1(OC(=O)COCCN2CCS(=O)(=O)CC2)CCCCC1 |
| InChI | InChI=1S/C15H27NO5S/c1-15(5-3-2-4-6-15)21-14(17)13-20-10-7-16-8-11-22(18,19)12-9-16/h2-13H2,1H3 |
| InChIKey | WXNBITQEIYOFLR-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (1-methylcyclohexyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylcyclohexyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate?
The IUPAC name of (1-methylcyclohexyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate (CID 58283248) is (1-methylcyclohexyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate.
What is the SMILES notation for (1-methylcyclohexyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate?
The canonical SMILES for (1-methylcyclohexyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate is CC1(OC(=O)COCCN2CCS(=O)(=O)CC2)CCCCC1.
What is the InChIKey of (1-methylcyclohexyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate?
The InChIKey is WXNBITQEIYOFLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO5S/c1-15(5-3-2-4-6-15)21-14(17)13-20-10-7-16-8-11-22(18,19)12-9-16/h2-13H2,1H3.
What are the key properties of (1-methylcyclohexyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate?
(1-methylcyclohexyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate has a molecular weight of 333.45 g/mol, XLogP of 1.00, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylcyclohexyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate is sourced from PubChem (CID 58283248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).