About (1-ethylcyclohexyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate
(1-ethylcyclohexyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate (PubChem CID 58283324) has the molecular formula C16H29NO5S
and a molecular weight of 347.48 g/mol. Its IUPAC name is (1-ethylcyclohexyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate.
Molecular Properties
| Compound Name | (1-ethylcyclohexyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate |
| PubChem CID | 58283324 |
| Molecular Formula | C16H29NO5S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | (1-ethylcyclohexyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate |
| SMILES | CCC1(OC(=O)COCCN2CCS(=O)(=O)CC2)CCCCC1 |
| InChI | InChI=1S/C16H29NO5S/c1-2-16(6-4-3-5-7-16)22-15(18)14-21-11-8-17-9-12-23(19,20)13-10-17/h2-14H2,1H3 |
| InChIKey | FTFPSJAIZFYJQL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (1-ethylcyclohexyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylcyclohexyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate?
The IUPAC name of (1-ethylcyclohexyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate (CID 58283324) is (1-ethylcyclohexyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate.
What is the SMILES notation for (1-ethylcyclohexyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate?
The canonical SMILES for (1-ethylcyclohexyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate is CCC1(OC(=O)COCCN2CCS(=O)(=O)CC2)CCCCC1.
What is the InChIKey of (1-ethylcyclohexyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate?
The InChIKey is FTFPSJAIZFYJQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29NO5S/c1-2-16(6-4-3-5-7-16)22-15(18)14-21-11-8-17-9-12-23(19,20)13-10-17/h2-14H2,1H3.
What are the key properties of (1-ethylcyclohexyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate?
(1-ethylcyclohexyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate has a molecular weight of 347.48 g/mol, XLogP of 1.39, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylcyclohexyl) 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]acetate is sourced from PubChem (CID 58283324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).