About (4-methoxyphenyl)methyl 1,1-dioxo-1,4-thiazinane-4-carboxylate
(4-methoxyphenyl)methyl 1,1-dioxo-1,4-thiazinane-4-carboxylate (PubChem CID 58283449) has the molecular formula C13H17NO5S
and a molecular weight of 299.35 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 1,1-dioxo-1,4-thiazinane-4-carboxylate.
Molecular Properties
| Compound Name | (4-methoxyphenyl)methyl 1,1-dioxo-1,4-thiazinane-4-carboxylate |
| PubChem CID | 58283449 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | (4-methoxyphenyl)methyl 1,1-dioxo-1,4-thiazinane-4-carboxylate |
| SMILES | COc1ccc(COC(=O)N2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C13H17NO5S/c1-18-12-4-2-11(3-5-12)10-19-13(15)14-6-8-20(16,17)9-7-14/h2-5H,6-10H2,1H3 |
| InChIKey | LYOGYYNQQGXSIX-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-methoxyphenyl)methyl 1,1-dioxo-1,4-thiazinane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl)methyl 1,1-dioxo-1,4-thiazinane-4-carboxylate?
The IUPAC name of (4-methoxyphenyl)methyl 1,1-dioxo-1,4-thiazinane-4-carboxylate (CID 58283449) is (4-methoxyphenyl)methyl 1,1-dioxo-1,4-thiazinane-4-carboxylate.
What is the SMILES notation for (4-methoxyphenyl)methyl 1,1-dioxo-1,4-thiazinane-4-carboxylate?
The canonical SMILES for (4-methoxyphenyl)methyl 1,1-dioxo-1,4-thiazinane-4-carboxylate is COc1ccc(COC(=O)N2CCS(=O)(=O)CC2)cc1.
What is the InChIKey of (4-methoxyphenyl)methyl 1,1-dioxo-1,4-thiazinane-4-carboxylate?
The InChIKey is LYOGYYNQQGXSIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO5S/c1-18-12-4-2-11(3-5-12)10-19-13(15)14-6-8-20(16,17)9-7-14/h2-5H,6-10H2,1H3.
What are the key properties of (4-methoxyphenyl)methyl 1,1-dioxo-1,4-thiazinane-4-carboxylate?
(4-methoxyphenyl)methyl 1,1-dioxo-1,4-thiazinane-4-carboxylate has a molecular weight of 299.35 g/mol, XLogP of 1.06, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl)methyl 1,1-dioxo-1,4-thiazinane-4-carboxylate is sourced from PubChem (CID 58283449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).