About 5-(propan-2-yloxymethyl)-1,2-dihydroacenaphthylene
5-(propan-2-yloxymethyl)-1,2-dihydroacenaphthylene (PubChem CID 58283493) has the molecular formula C16H18O
and a molecular weight of 226.32 g/mol. Its IUPAC name is 5-(propan-2-yloxymethyl)-1,2-dihydroacenaphthylene.
Molecular Properties
| Compound Name | 5-(propan-2-yloxymethyl)-1,2-dihydroacenaphthylene |
| PubChem CID | 58283493 |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 5-(propan-2-yloxymethyl)-1,2-dihydroacenaphthylene |
| SMILES | CC(C)OCc1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C16H18O/c1-11(2)17-10-14-9-8-13-7-6-12-4-3-5-15(14)16(12)13/h3-5,8-9,11H,6-7,10H2,1-2H3 |
| InChIKey | WDDFXHIJFZSKIU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(propan-2-yloxymethyl)-1,2-dihydroacenaphthylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(propan-2-yloxymethyl)-1,2-dihydroacenaphthylene?
The IUPAC name of 5-(propan-2-yloxymethyl)-1,2-dihydroacenaphthylene (CID 58283493) is 5-(propan-2-yloxymethyl)-1,2-dihydroacenaphthylene.
What is the SMILES notation for 5-(propan-2-yloxymethyl)-1,2-dihydroacenaphthylene?
The canonical SMILES for 5-(propan-2-yloxymethyl)-1,2-dihydroacenaphthylene is CC(C)OCc1ccc2c3c(cccc13)CC2.
What is the InChIKey of 5-(propan-2-yloxymethyl)-1,2-dihydroacenaphthylene?
The InChIKey is WDDFXHIJFZSKIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O/c1-11(2)17-10-14-9-8-13-7-6-12-4-3-5-15(14)16(12)13/h3-5,8-9,11H,6-7,10H2,1-2H3.
What are the key properties of 5-(propan-2-yloxymethyl)-1,2-dihydroacenaphthylene?
5-(propan-2-yloxymethyl)-1,2-dihydroacenaphthylene has a molecular weight of 226.32 g/mol, XLogP of 3.86, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(propan-2-yloxymethyl)-1,2-dihydroacenaphthylene is sourced from PubChem (CID 58283493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).