About 4-methylidene-5-propan-2-yl-1,2-dihydropyridin-2-ide;uranium
4-methylidene-5-propan-2-yl-1,2-dihydropyridin-2-ide;uranium (PubChem CID 58283640) has the molecular formula C9H12NU2-
and a molecular weight of 610.26 g/mol. Its IUPAC name is 4-methylidene-5-propan-2-yl-1,2-dihydropyridin-2-ide;uranium.
Molecular Properties
| Compound Name | 4-methylidene-5-propan-2-yl-1,2-dihydropyridin-2-ide;uranium |
| PubChem CID | 58283640 |
| Molecular Formula | C9H12NU2- |
| Molecular Weight | 610.26 g/mol |
| Exact Mass | 610.20 |
| IUPAC Name | 4-methylidene-5-propan-2-yl-1,2-dihydropyridin-2-ide;uranium |
| SMILES | C=C1C=[C-]NC=C1C(C)C.[U].[U] |
| InChI | InChI=1S/C9H12N.2U/c1-7(2)9-6-10-5-4-8(9)3;;/h4,6-7,10H,3H2,1-2H3;;/q-1;; |
| InChIKey | ZUCKHKSFIRMXAA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 610.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-methylidene-5-propan-2-yl-1,2-dihydropyridin-2-ide;uranium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylidene-5-propan-2-yl-1,2-dihydropyridin-2-ide;uranium?
The IUPAC name of 4-methylidene-5-propan-2-yl-1,2-dihydropyridin-2-ide;uranium (CID 58283640) is 4-methylidene-5-propan-2-yl-1,2-dihydropyridin-2-ide;uranium.
What is the SMILES notation for 4-methylidene-5-propan-2-yl-1,2-dihydropyridin-2-ide;uranium?
The canonical SMILES for 4-methylidene-5-propan-2-yl-1,2-dihydropyridin-2-ide;uranium is C=C1C=[C-]NC=C1C(C)C.[U].[U].
What is the InChIKey of 4-methylidene-5-propan-2-yl-1,2-dihydropyridin-2-ide;uranium?
The InChIKey is ZUCKHKSFIRMXAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N.2U/c1-7(2)9-6-10-5-4-8(9)3;;/h4,6-7,10H,3H2,1-2H3;;/q-1;;.
What are the key properties of 4-methylidene-5-propan-2-yl-1,2-dihydropyridin-2-ide;uranium?
4-methylidene-5-propan-2-yl-1,2-dihydropyridin-2-ide;uranium has a molecular weight of 610.26 g/mol, XLogP of 2.00, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylidene-5-propan-2-yl-1,2-dihydropyridin-2-ide;uranium is sourced from PubChem (CID 58283640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).