C23H23ClN4OS — CID 58283707
N'-[4-[[3-[(4-chlorophenyl)methyl]-4-cyano-1,2-thiazol-5-yl]oxy]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 58283707) has the molecular formula C23H23ClN4OS and a molecular weight of 438.98 g/mol. Its IUPAC name is N'-[4-[[3-[(4-chlorophenyl)methyl]-4-cyano-1,2-thiazol-5-yl]oxy]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[4-[[3-[(4-chlorophenyl)methyl]-4-cyano-1,2-thiazol-5-yl]oxy]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 58283707 |
| Molecular Formula | C23H23ClN4OS |
| Molecular Weight | 438.98 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | N'-[4-[[3-[(4-chlorophenyl)methyl]-4-cyano-1,2-thiazol-5-yl]oxy]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Oc2snc(Cc3ccc(Cl)cc3)c2C#N)cc1C |
| InChI | InChI=1S/C23H23ClN4OS/c1-5-28(4)14-26-20-10-16(3)22(11-15(20)2)29-23-19(13-25)21(27-30-23)12-17-6-8-18(24)9-7-17/h6-11,14H,5,12H2,1-4H3/b26-14+ |
| InChIKey | NTDGMRLRJXICCB-VULFUBBASA-N |
| XLogP | 6.28 |
| TPSA | 61.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.98 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|