About 4-[(4-chloro-3-phenyl-1,2-thiazol-5-yl)oxy]-2,5-dimethylaniline
4-[(4-chloro-3-phenyl-1,2-thiazol-5-yl)oxy]-2,5-dimethylaniline (PubChem CID 58283709) has the molecular formula C17H15ClN2OS
and a molecular weight of 330.84 g/mol. Its IUPAC name is 4-[(4-chloro-3-phenyl-1,2-thiazol-5-yl)oxy]-2,5-dimethylaniline.
Molecular Properties
| Compound Name | 4-[(4-chloro-3-phenyl-1,2-thiazol-5-yl)oxy]-2,5-dimethylaniline |
| PubChem CID | 58283709 |
| Molecular Formula | C17H15ClN2OS |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 4-[(4-chloro-3-phenyl-1,2-thiazol-5-yl)oxy]-2,5-dimethylaniline |
| SMILES | Cc1cc(Oc2snc(-c3ccccc3)c2Cl)c(C)cc1N |
| InChI | InChI=1S/C17H15ClN2OS/c1-10-9-14(11(2)8-13(10)19)21-17-15(18)16(20-22-17)12-6-4-3-5-7-12/h3-9H,19H2,1-2H3 |
| InChIKey | IXFAQNMKCCNKFV-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-chloro-3-phenyl-1,2-thiazol-5-yl)oxy]-2,5-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-chloro-3-phenyl-1,2-thiazol-5-yl)oxy]-2,5-dimethylaniline?
The IUPAC name of 4-[(4-chloro-3-phenyl-1,2-thiazol-5-yl)oxy]-2,5-dimethylaniline (CID 58283709) is 4-[(4-chloro-3-phenyl-1,2-thiazol-5-yl)oxy]-2,5-dimethylaniline.
What is the SMILES notation for 4-[(4-chloro-3-phenyl-1,2-thiazol-5-yl)oxy]-2,5-dimethylaniline?
The canonical SMILES for 4-[(4-chloro-3-phenyl-1,2-thiazol-5-yl)oxy]-2,5-dimethylaniline is Cc1cc(Oc2snc(-c3ccccc3)c2Cl)c(C)cc1N.
What is the InChIKey of 4-[(4-chloro-3-phenyl-1,2-thiazol-5-yl)oxy]-2,5-dimethylaniline?
The InChIKey is IXFAQNMKCCNKFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15ClN2OS/c1-10-9-14(11(2)8-13(10)19)21-17-15(18)16(20-22-17)12-6-4-3-5-7-12/h3-9H,19H2,1-2H3.
What are the key properties of 4-[(4-chloro-3-phenyl-1,2-thiazol-5-yl)oxy]-2,5-dimethylaniline?
4-[(4-chloro-3-phenyl-1,2-thiazol-5-yl)oxy]-2,5-dimethylaniline has a molecular weight of 330.84 g/mol, XLogP of 5.45, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-chloro-3-phenyl-1,2-thiazol-5-yl)oxy]-2,5-dimethylaniline is sourced from PubChem (CID 58283709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).