C24H24F3NO3 — CID 58283727
3-[2,6-dimethyl-3-(3,4,5-trifluorophenyl)phenyl]-4-hydroxy-8-methoxy-1-azaspiro[4.5]dec-3-en-2-one (PubChem CID 58283727) has the molecular formula C24H24F3NO3 and a molecular weight of 431.45 g/mol. Its IUPAC name is 3-[2,6-dimethyl-3-(3,4,5-trifluorophenyl)phenyl]-4-hydroxy-8-methoxy-1-azaspiro[4.5]dec-3-en-2-one.
| Compound Name | 3-[2,6-dimethyl-3-(3,4,5-trifluorophenyl)phenyl]-4-hydroxy-8-methoxy-1-azaspiro[4.5]dec-3-en-2-one |
|---|---|
| PubChem CID | 58283727 |
| Molecular Formula | C24H24F3NO3 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 3-[2,6-dimethyl-3-(3,4,5-trifluorophenyl)phenyl]-4-hydroxy-8-methoxy-1-azaspiro[4.5]dec-3-en-2-one |
| SMILES | COC1CCC2(CC1)NC(=O)C(c1c(C)ccc(-c3cc(F)c(F)c(F)c3)c1C)=C2O |
| InChI | InChI=1S/C24H24F3NO3/c1-12-4-5-16(14-10-17(25)21(27)18(26)11-14)13(2)19(12)20-22(29)24(28-23(20)30)8-6-15(31-3)7-9-24/h4-5,10-11,15,29H,6-9H2,1-3H3,(H,28,30) |
| InChIKey | KCDIBQMWOBQIJD-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|