About ethynyl [3-[5-(4-fluorophenyl)-2-methylphenyl]-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] carbonate
ethynyl [3-[5-(4-fluorophenyl)-2-methylphenyl]-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] carbonate (PubChem CID 58283731) has the molecular formula C26H24FNO5
and a molecular weight of 449.48 g/mol. Its IUPAC name is ethynyl [3-[5-(4-fluorophenyl)-2-methylphenyl]-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] carbonate.
Molecular Properties
| Compound Name | ethynyl [3-[5-(4-fluorophenyl)-2-methylphenyl]-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] carbonate |
| PubChem CID | 58283731 |
| Molecular Formula | C26H24FNO5 |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | ethynyl [3-[5-(4-fluorophenyl)-2-methylphenyl]-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] carbonate |
| SMILES | C#COC(=O)OC1=C(c2cc(-c3ccc(F)cc3)ccc2C)C(=O)NC12CCC(OC)CC2 |
| InChI | InChI=1S/C26H24FNO5/c1-4-32-25(30)33-23-22(24(29)28-26(23)13-11-20(31-3)12-14-26)21-15-18(6-5-16(21)2)17-7-9-19(27)10-8-17/h1,5-10,15,20H,11-14H2,2-3H3,(H,28,29) |
| InChIKey | SKCATWKUDRGOLV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethynyl [3-[5-(4-fluorophenyl)-2-methylphenyl]-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethynyl [3-[5-(4-fluorophenyl)-2-methylphenyl]-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] carbonate?
The IUPAC name of ethynyl [3-[5-(4-fluorophenyl)-2-methylphenyl]-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] carbonate (CID 58283731) is ethynyl [3-[5-(4-fluorophenyl)-2-methylphenyl]-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] carbonate.
What is the SMILES notation for ethynyl [3-[5-(4-fluorophenyl)-2-methylphenyl]-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] carbonate?
The canonical SMILES for ethynyl [3-[5-(4-fluorophenyl)-2-methylphenyl]-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] carbonate is C#COC(=O)OC1=C(c2cc(-c3ccc(F)cc3)ccc2C)C(=O)NC12CCC(OC)CC2.
What is the InChIKey of ethynyl [3-[5-(4-fluorophenyl)-2-methylphenyl]-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] carbonate?
The InChIKey is SKCATWKUDRGOLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24FNO5/c1-4-32-25(30)33-23-22(24(29)28-26(23)13-11-20(31-3)12-14-26)21-15-18(6-5-16(21)2)17-7-9-19(27)10-8-17/h1,5-10,15,20H,11-14H2,2-3H3,(H,28,29).
What are the key properties of ethynyl [3-[5-(4-fluorophenyl)-2-methylphenyl]-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] carbonate?
ethynyl [3-[5-(4-fluorophenyl)-2-methylphenyl]-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] carbonate has a molecular weight of 449.48 g/mol, XLogP of 4.71, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethynyl [3-[5-(4-fluorophenyl)-2-methylphenyl]-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] carbonate is sourced from PubChem (CID 58283731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).