C4Cl2F6 — CID 582842
4,4-dichloro-1,1,2,3,3,4-hexafluorobut-1-ene (PubChem CID 582842) has the molecular formula C4Cl2F6 and a molecular weight of 232.94 g/mol. Its IUPAC name is 4,4-dichloro-1,1,2,3,3,4-hexafluorobut-1-ene.
| Compound Name | 4,4-dichloro-1,1,2,3,3,4-hexafluorobut-1-ene |
|---|---|
| PubChem CID | 582842 |
| Molecular Formula | C4Cl2F6 |
| Molecular Weight | 232.94 g/mol |
| Exact Mass | 231.93 |
| IUPAC Name | 4,4-dichloro-1,1,2,3,3,4-hexafluorobut-1-ene |
| SMILES | FC(F)=C(F)C(F)(F)C(F)(Cl)Cl |
| InChI | InChI=1S/C4Cl2F6/c5-4(6,12)3(10,11)1(7)2(8)9 |
| InChIKey | OZAWCRZCYBVMBW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.94 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|