C26H18Cl2N4O4S — CID 58284272
6-chloro-2-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-4-[4-[(2S)-2,3-dihydroxypropoxy]phenyl]-5-isocyanopyridine-3-carbonitrile (PubChem CID 58284272) has the molecular formula C26H18Cl2N4O4S and a molecular weight of 553.43 g/mol. Its IUPAC name is 6-chloro-2-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-4-[4-[(2S)-2,3-dihydroxypropoxy]phenyl]-5-isocyanopyridine-3-carbonitrile.
| Compound Name | 6-chloro-2-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-4-[4-[(2S)-2,3-dihydroxypropoxy]phenyl]-5-isocyanopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 58284272 |
| Molecular Formula | C26H18Cl2N4O4S |
| Molecular Weight | 553.43 g/mol |
| Exact Mass | 552.04 |
| IUPAC Name | 6-chloro-2-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-4-[4-[(2S)-2,3-dihydroxypropoxy]phenyl]-5-isocyanopyridine-3-carbonitrile |
| SMILES | [C-]#[N+]c1c(Cl)nc(SCc2coc(-c3ccc(Cl)cc3)n2)c(C#N)c1-c1ccc(OC[C@@H](O)CO)cc1 |
| InChI | InChI=1S/C26H18Cl2N4O4S/c1-30-23-22(15-4-8-20(9-5-15)35-13-19(34)11-33)21(10-29)26(32-24(23)28)37-14-18-12-36-25(31-18)16-2-6-17(27)7-3-16/h2-9,12,19,33-34H,11,13-14H2/t19-/m0/s1 |
| InChIKey | AQEHHVHITTUJSY-IBGZPJMESA-N |
| XLogP | 6.16 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.43 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|