C22H25ClFN3O3 — CID 58284547
tert-butyl (3R)-3-[2-[5-chloro-4-(6-fluoro-2-pyridinyl)-2-pyridinyl]acetyl]piperidine-1-carboxylate (PubChem CID 58284547) has the molecular formula C22H25ClFN3O3 and a molecular weight of 433.91 g/mol. Its IUPAC name is tert-butyl (3R)-3-[2-[5-chloro-4-(6-fluoro-2-pyridinyl)-2-pyridinyl]acetyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[2-[5-chloro-4-(6-fluoro-2-pyridinyl)-2-pyridinyl]acetyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58284547 |
| Molecular Formula | C22H25ClFN3O3 |
| Molecular Weight | 433.91 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | tert-butyl (3R)-3-[2-[5-chloro-4-(6-fluoro-2-pyridinyl)-2-pyridinyl]acetyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C(=O)Cc2cc(-c3cccc(F)n3)c(Cl)cn2)C1 |
| InChI | InChI=1S/C22H25ClFN3O3/c1-22(2,3)30-21(29)27-9-5-6-14(13-27)19(28)11-15-10-16(17(23)12-25-15)18-7-4-8-20(24)26-18/h4,7-8,10,12,14H,5-6,9,11,13H2,1-3H3/t14-/m1/s1 |
| InChIKey | PUAWFRRLXWDOMR-CQSZACIVSA-N |
| XLogP | 4.69 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.91 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|