About 5-chloro-4-[6-[[(4S)-2,2-dimethyloxan-4-yl]methylamino]-2-pyridinyl]pyridin-2-amine
5-chloro-4-[6-[[(4S)-2,2-dimethyloxan-4-yl]methylamino]-2-pyridinyl]pyridin-2-amine (PubChem CID 58284620) has the molecular formula C18H23ClN4O
and a molecular weight of 346.86 g/mol. Its IUPAC name is 5-chloro-4-[6-[[(4S)-2,2-dimethyloxan-4-yl]methylamino]-2-pyridinyl]pyridin-2-amine.
Molecular Properties
| Compound Name | 5-chloro-4-[6-[[(4S)-2,2-dimethyloxan-4-yl]methylamino]-2-pyridinyl]pyridin-2-amine |
| PubChem CID | 58284620 |
| Molecular Formula | C18H23ClN4O |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 5-chloro-4-[6-[[(4S)-2,2-dimethyloxan-4-yl]methylamino]-2-pyridinyl]pyridin-2-amine |
| SMILES | CC1(C)C[C@@H](CNc2cccc(-c3cc(N)ncc3Cl)n2)CCO1 |
| InChI | InChI=1S/C18H23ClN4O/c1-18(2)9-12(6-7-24-18)10-22-17-5-3-4-15(23-17)13-8-16(20)21-11-14(13)19/h3-5,8,11-12H,6-7,9-10H2,1-2H3,(H2,20,21)(H,22,23)/t12-/m0/s1 |
| InChIKey | BYWMGYCGIPBRRP-LBPRGKRZSA-N |
| XLogP | 4.00 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-chloro-4-[6-[[(4S)-2,2-dimethyloxan-4-yl]methylamino]-2-pyridinyl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-[6-[[(4S)-2,2-dimethyloxan-4-yl]methylamino]-2-pyridinyl]pyridin-2-amine?
The IUPAC name of 5-chloro-4-[6-[[(4S)-2,2-dimethyloxan-4-yl]methylamino]-2-pyridinyl]pyridin-2-amine (CID 58284620) is 5-chloro-4-[6-[[(4S)-2,2-dimethyloxan-4-yl]methylamino]-2-pyridinyl]pyridin-2-amine.
What is the SMILES notation for 5-chloro-4-[6-[[(4S)-2,2-dimethyloxan-4-yl]methylamino]-2-pyridinyl]pyridin-2-amine?
The canonical SMILES for 5-chloro-4-[6-[[(4S)-2,2-dimethyloxan-4-yl]methylamino]-2-pyridinyl]pyridin-2-amine is CC1(C)C[C@@H](CNc2cccc(-c3cc(N)ncc3Cl)n2)CCO1.
What is the InChIKey of 5-chloro-4-[6-[[(4S)-2,2-dimethyloxan-4-yl]methylamino]-2-pyridinyl]pyridin-2-amine?
The InChIKey is BYWMGYCGIPBRRP-LBPRGKRZSA-N. The full InChI is InChI=1S/C18H23ClN4O/c1-18(2)9-12(6-7-24-18)10-22-17-5-3-4-15(23-17)13-8-16(20)21-11-14(13)19/h3-5,8,11-12H,6-7,9-10H2,1-2H3,(H2,20,21)(H,22,23)/t12-/m0/s1.
What are the key properties of 5-chloro-4-[6-[[(4S)-2,2-dimethyloxan-4-yl]methylamino]-2-pyridinyl]pyridin-2-amine?
5-chloro-4-[6-[[(4S)-2,2-dimethyloxan-4-yl]methylamino]-2-pyridinyl]pyridin-2-amine has a molecular weight of 346.86 g/mol, XLogP of 4.00, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-[6-[[(4S)-2,2-dimethyloxan-4-yl]methylamino]-2-pyridinyl]pyridin-2-amine is sourced from PubChem (CID 58284620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).