About N-cyclopropyl-5-(5,6-difluoro-2-methylbenzimidazol-1-yl)thiophene-2-carboxamide
N-cyclopropyl-5-(5,6-difluoro-2-methylbenzimidazol-1-yl)thiophene-2-carboxamide (PubChem CID 58284877) has the molecular formula C16H13F2N3OS
and a molecular weight of 333.36 g/mol. Its IUPAC name is N-cyclopropyl-5-(5,6-difluoro-2-methylbenzimidazol-1-yl)thiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-cyclopropyl-5-(5,6-difluoro-2-methylbenzimidazol-1-yl)thiophene-2-carboxamide |
| PubChem CID | 58284877 |
| Molecular Formula | C16H13F2N3OS |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | N-cyclopropyl-5-(5,6-difluoro-2-methylbenzimidazol-1-yl)thiophene-2-carboxamide |
| SMILES | Cc1nc2cc(F)c(F)cc2n1-c1ccc(C(=O)NC2CC2)s1 |
| InChI | InChI=1S/C16H13F2N3OS/c1-8-19-12-6-10(17)11(18)7-13(12)21(8)15-5-4-14(23-15)16(22)20-9-2-3-9/h4-7,9H,2-3H2,1H3,(H,20,22) |
| InChIKey | FBZQWYOZXKENJW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclopropyl-5-(5,6-difluoro-2-methylbenzimidazol-1-yl)thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-5-(5,6-difluoro-2-methylbenzimidazol-1-yl)thiophene-2-carboxamide?
The IUPAC name of N-cyclopropyl-5-(5,6-difluoro-2-methylbenzimidazol-1-yl)thiophene-2-carboxamide (CID 58284877) is N-cyclopropyl-5-(5,6-difluoro-2-methylbenzimidazol-1-yl)thiophene-2-carboxamide.
What is the SMILES notation for N-cyclopropyl-5-(5,6-difluoro-2-methylbenzimidazol-1-yl)thiophene-2-carboxamide?
The canonical SMILES for N-cyclopropyl-5-(5,6-difluoro-2-methylbenzimidazol-1-yl)thiophene-2-carboxamide is Cc1nc2cc(F)c(F)cc2n1-c1ccc(C(=O)NC2CC2)s1.
What is the InChIKey of N-cyclopropyl-5-(5,6-difluoro-2-methylbenzimidazol-1-yl)thiophene-2-carboxamide?
The InChIKey is FBZQWYOZXKENJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F2N3OS/c1-8-19-12-6-10(17)11(18)7-13(12)21(8)15-5-4-14(23-15)16(22)20-9-2-3-9/h4-7,9H,2-3H2,1H3,(H,20,22).
What are the key properties of N-cyclopropyl-5-(5,6-difluoro-2-methylbenzimidazol-1-yl)thiophene-2-carboxamide?
N-cyclopropyl-5-(5,6-difluoro-2-methylbenzimidazol-1-yl)thiophene-2-carboxamide has a molecular weight of 333.36 g/mol, XLogP of 3.57, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-5-(5,6-difluoro-2-methylbenzimidazol-1-yl)thiophene-2-carboxamide is sourced from PubChem (CID 58284877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).