C11H12N4OS2 — CID 58285392
N-(2-methoxyethyl)-5-thiophen-3-ylimidazo[2,1-b][1,3,4]thiadiazol-2-amine (PubChem CID 58285392) has the molecular formula C11H12N4OS2 and a molecular weight of 280.38 g/mol. Its IUPAC name is N-(2-methoxyethyl)-5-thiophen-3-ylimidazo[2,1-b][1,3,4]thiadiazol-2-amine.
| Compound Name | N-(2-methoxyethyl)-5-thiophen-3-ylimidazo[2,1-b][1,3,4]thiadiazol-2-amine |
|---|---|
| PubChem CID | 58285392 |
| Molecular Formula | C11H12N4OS2 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | N-(2-methoxyethyl)-5-thiophen-3-ylimidazo[2,1-b][1,3,4]thiadiazol-2-amine |
| SMILES | COCCNc1nn2c(-c3ccsc3)cnc2s1 |
| InChI | InChI=1S/C11H12N4OS2/c1-16-4-3-12-10-14-15-9(6-13-11(15)18-10)8-2-5-17-7-8/h2,5-7H,3-4H2,1H3,(H,12,14) |
| InChIKey | PSPGMZAEHRFFAB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|