C15H18N4O3S — CID 58285508
3-[[5-(3,4-dimethoxyphenyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]amino]propan-1-ol (PubChem CID 58285508) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is 3-[[5-(3,4-dimethoxyphenyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]amino]propan-1-ol.
| Compound Name | 3-[[5-(3,4-dimethoxyphenyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 58285508 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 3-[[5-(3,4-dimethoxyphenyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]amino]propan-1-ol |
| SMILES | COc1ccc(-c2cnc3sc(NCCCO)nn23)cc1OC |
| InChI | InChI=1S/C15H18N4O3S/c1-21-12-5-4-10(8-13(12)22-2)11-9-17-15-19(11)18-14(23-15)16-6-3-7-20/h4-5,8-9,20H,3,6-7H2,1-2H3,(H,16,18) |
| InChIKey | SGHMDNFNVXSRLW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|