C13H13FN4OS — CID 58285522
3-[[5-(3-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]amino]propan-1-ol (PubChem CID 58285522) has the molecular formula C13H13FN4OS and a molecular weight of 292.34 g/mol. Its IUPAC name is 3-[[5-(3-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]amino]propan-1-ol.
| Compound Name | 3-[[5-(3-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 58285522 |
| Molecular Formula | C13H13FN4OS |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 3-[[5-(3-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]amino]propan-1-ol |
| SMILES | OCCCNc1nn2c(-c3cccc(F)c3)cnc2s1 |
| InChI | InChI=1S/C13H13FN4OS/c14-10-4-1-3-9(7-10)11-8-16-13-18(11)17-12(20-13)15-5-2-6-19/h1,3-4,7-8,19H,2,5-6H2,(H,15,17) |
| InChIKey | ZOEHMSGFIIPOBW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|