C14H15N5O2S — CID 58285613
3-[2-(3-hydroxypropylamino)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]benzamide (PubChem CID 58285613) has the molecular formula C14H15N5O2S and a molecular weight of 317.37 g/mol. Its IUPAC name is 3-[2-(3-hydroxypropylamino)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]benzamide.
| Compound Name | 3-[2-(3-hydroxypropylamino)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]benzamide |
|---|---|
| PubChem CID | 58285613 |
| Molecular Formula | C14H15N5O2S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 3-[2-(3-hydroxypropylamino)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]benzamide |
| SMILES | NC(=O)c1cccc(-c2cnc3sc(NCCCO)nn23)c1 |
| InChI | InChI=1S/C14H15N5O2S/c15-12(21)10-4-1-3-9(7-10)11-8-17-14-19(11)18-13(22-14)16-5-2-6-20/h1,3-4,7-8,20H,2,5-6H2,(H2,15,21)(H,16,18) |
| InChIKey | IVHURIATDRDLPG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 105.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|