C17H14N4S — CID 58285758
N-benzyl-5-phenylimidazo[2,1-b][1,3,4]thiadiazol-2-amine (PubChem CID 58285758) has the molecular formula C17H14N4S and a molecular weight of 306.39 g/mol. Its IUPAC name is N-benzyl-5-phenylimidazo[2,1-b][1,3,4]thiadiazol-2-amine.
| Compound Name | N-benzyl-5-phenylimidazo[2,1-b][1,3,4]thiadiazol-2-amine |
|---|---|
| PubChem CID | 58285758 |
| Molecular Formula | C17H14N4S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | N-benzyl-5-phenylimidazo[2,1-b][1,3,4]thiadiazol-2-amine |
| SMILES | c1ccc(CNc2nn3c(-c4ccccc4)cnc3s2)cc1 |
| InChI | InChI=1S/C17H14N4S/c1-3-7-13(8-4-1)11-18-16-20-21-15(12-19-17(21)22-16)14-9-5-2-6-10-14/h1-10,12H,11H2,(H,18,20) |
| InChIKey | XJLSXAYIANSEQV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |