C22H26N6O2S — CID 58285816
5-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]-N-(2-phenoxyethyl)imidazo[2,1-b][1,3,4]thiadiazol-2-amine (PubChem CID 58285816) has the molecular formula C22H26N6O2S and a molecular weight of 438.56 g/mol. Its IUPAC name is 5-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]-N-(2-phenoxyethyl)imidazo[2,1-b][1,3,4]thiadiazol-2-amine.
| Compound Name | 5-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]-N-(2-phenoxyethyl)imidazo[2,1-b][1,3,4]thiadiazol-2-amine |
|---|---|
| PubChem CID | 58285816 |
| Molecular Formula | C22H26N6O2S |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 5-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]-N-(2-phenoxyethyl)imidazo[2,1-b][1,3,4]thiadiazol-2-amine |
| SMILES | CN(C)CCCOc1ccc(-c2cnc3sc(NCCOc4ccccc4)nn23)cn1 |
| InChI | InChI=1S/C22H26N6O2S/c1-27(2)12-6-13-30-20-10-9-17(15-24-20)19-16-25-22-28(19)26-21(31-22)23-11-14-29-18-7-4-3-5-8-18/h3-5,7-10,15-16H,6,11-14H2,1-2H3,(H,23,26) |
| InChIKey | IJOXWFZKFRPVIH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 76.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|