C32H35N5O4 — CID 58286452
(2S)-2-tert-butyl-1-[(1S,4S)-5-[5-(3,5-dimethyl-1,2-oxazol-4-yl)pyridine-2-carbonyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-4-(1H-indol-2-yl)butane-1,4-dione (PubChem CID 58286452) has the molecular formula C32H35N5O4 and a molecular weight of 553.66 g/mol. Its IUPAC name is (2S)-2-tert-butyl-1-[(1S,4S)-5-[5-(3,5-dimethyl-1,2-oxazol-4-yl)pyridine-2-carbonyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-4-(1H-indol-2-yl)butane-1,4-dione.
| Compound Name | (2S)-2-tert-butyl-1-[(1S,4S)-5-[5-(3,5-dimethyl-1,2-oxazol-4-yl)pyridine-2-carbonyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-4-(1H-indol-2-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 58286452 |
| Molecular Formula | C32H35N5O4 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.27 |
| IUPAC Name | (2S)-2-tert-butyl-1-[(1S,4S)-5-[5-(3,5-dimethyl-1,2-oxazol-4-yl)pyridine-2-carbonyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-4-(1H-indol-2-yl)butane-1,4-dione |
| SMILES | Cc1noc(C)c1-c1ccc(C(=O)N2C[C@@H]3C[C@H]2CN3C(=O)[C@@H](CC(=O)c2cc3ccccc3[nH]2)C(C)(C)C)nc1 |
| InChI | InChI=1S/C32H35N5O4/c1-18-29(19(2)41-35-18)21-10-11-26(33-15-21)31(40)37-17-22-13-23(37)16-36(22)30(39)24(32(3,4)5)14-28(38)27-12-20-8-6-7-9-25(20)34-27/h6-12,15,22-24,34H,13-14,16-17H2,1-5H3/t22-,23-,24+/m0/s1 |
| InChIKey | GKSVVYNIOPDXRL-KMDXXIMOSA-N |
| XLogP | 5.20 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |