C19H20FNO3 — CID 58287429
(3S)-2,2,4,5,5-pentadeuterio-3-[dideuterio-[(2,2-dideuterio-1,3-benzodioxol-5-yl)oxy]methyl]-4-(4-fluorophenyl)piperidine (PubChem CID 58287429) has the molecular formula C19H20FNO3 and a molecular weight of 338.43 g/mol. Its IUPAC name is (3S)-2,2,4,5,5-pentadeuterio-3-[dideuterio-[(2,2-dideuterio-1,3-benzodioxol-5-yl)oxy]methyl]-4-(4-fluorophenyl)piperidine.
| Compound Name | (3S)-2,2,4,5,5-pentadeuterio-3-[dideuterio-[(2,2-dideuterio-1,3-benzodioxol-5-yl)oxy]methyl]-4-(4-fluorophenyl)piperidine |
|---|---|
| PubChem CID | 58287429 |
| Molecular Formula | C19H20FNO3 |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | (3S)-2,2,4,5,5-pentadeuterio-3-[dideuterio-[(2,2-dideuterio-1,3-benzodioxol-5-yl)oxy]methyl]-4-(4-fluorophenyl)piperidine |
| SMILES | [2H]C1([2H])Oc2ccc(OC([2H])([2H])[C@@H]3C([2H])([2H])NCC([2H])([2H])C3([2H])c3ccc(F)cc3)cc2O1 |
| InChI | InChI=1S/C19H20FNO3/c20-15-3-1-13(2-4-15)17-7-8-21-10-14(17)11-22-16-5-6-18-19(9-16)24-12-23-18/h1-6,9,14,17,21H,7-8,10-12H2/t14-,17?/m0/s1/i7D2,10D2,11D2,12D2,17D |
| InChIKey | AHOUBRCZNHFOSL-MXDDZLFHSA-N |
| XLogP | 3.33 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |