C21H29FN5O5P — CID 58287971
3-[5-(deuteriomethyl)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3-fluorooxolan-2-yl]-8H-pyrido[2,3-d]pyrimidine-2,7-dione (PubChem CID 58287971) has the molecular formula C21H29FN5O5P and a molecular weight of 482.47 g/mol. Its IUPAC name is 3-[5-(deuteriomethyl)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3-fluorooxolan-2-yl]-8H-pyrido[2,3-d]pyrimidine-2,7-dione.
| Compound Name | 3-[5-(deuteriomethyl)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3-fluorooxolan-2-yl]-8H-pyrido[2,3-d]pyrimidine-2,7-dione |
|---|---|
| PubChem CID | 58287971 |
| Molecular Formula | C21H29FN5O5P |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 3-[5-(deuteriomethyl)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3-fluorooxolan-2-yl]-8H-pyrido[2,3-d]pyrimidine-2,7-dione |
| SMILES | [2H]CC1OC(n2cc3ccc(=O)[nH]c3nc2=O)C(F)C1OP(OCC[N+]#[C-])N(C(C)C)C(C)C |
| InChI | InChI=1S/C21H29FN5O5P/c1-12(2)27(13(3)4)33(30-10-9-23-6)32-18-14(5)31-20(17(18)22)26-11-15-7-8-16(28)24-19(15)25-21(26)29/h7-8,11-14,17-18,20H,9-10H2,1-5H3,(H,24,25,28,29)/i5D |
| InChIKey | UHLFYHHBHZSLSD-UICOGKGYSA-N |
| XLogP | 3.01 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|