C51H58N2O4 — CID 58288572
1-[[5-(2,5-dioxopyrrol-1-yl)-1,3,3-trimethylcyclohexyl]methyl]-3-(1-phenylethyl)-4-(2,4,6-triphenylheptyl)pyrrolidine-2,5-dione (PubChem CID 58288572) has the molecular formula C51H58N2O4 and a molecular weight of 763.04 g/mol. Its IUPAC name is 1-[[5-(2,5-dioxopyrrol-1-yl)-1,3,3-trimethylcyclohexyl]methyl]-3-(1-phenylethyl)-4-(2,4,6-triphenylheptyl)pyrrolidine-2,5-dione.
| Compound Name | 1-[[5-(2,5-dioxopyrrol-1-yl)-1,3,3-trimethylcyclohexyl]methyl]-3-(1-phenylethyl)-4-(2,4,6-triphenylheptyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58288572 |
| Molecular Formula | C51H58N2O4 |
| Molecular Weight | 763.04 g/mol |
| Exact Mass | 762.44 |
| IUPAC Name | 1-[[5-(2,5-dioxopyrrol-1-yl)-1,3,3-trimethylcyclohexyl]methyl]-3-(1-phenylethyl)-4-(2,4,6-triphenylheptyl)pyrrolidine-2,5-dione |
| SMILES | CC(CC(CC(CC1C(=O)N(CC2(C)CC(N3C(=O)C=CC3=O)CC(C)(C)C2)C(=O)C1C(C)c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C51H58N2O4/c1-35(37-18-10-6-11-19-37)28-41(39-22-14-8-15-23-39)29-42(40-24-16-9-17-25-40)30-44-47(36(2)38-20-12-7-13-21-38)49(57)52(48(44)56)34-51(5)32-43(31-50(3,4)33-51)53-45(54)26-27-46(53)55/h6-27,35-36,41-44,47H,28-34H2,1-5H3 |
| InChIKey | QXCMWQTYTUGHQY-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.04 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|