About 2-(2,5-dioxopyrrol-1-yl)ethyl propanoate
2-(2,5-dioxopyrrol-1-yl)ethyl propanoate (PubChem CID 58288592) has the molecular formula C9H11NO4
and a molecular weight of 197.19 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)ethyl propanoate.
Molecular Properties
| Compound Name | 2-(2,5-dioxopyrrol-1-yl)ethyl propanoate |
| PubChem CID | 58288592 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 2-(2,5-dioxopyrrol-1-yl)ethyl propanoate |
| SMILES | CCC(=O)OCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H11NO4/c1-2-9(13)14-6-5-10-7(11)3-4-8(10)12/h3-4H,2,5-6H2,1H3 |
| InChIKey | QREJQBFQTZRRJZ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dioxopyrrol-1-yl)ethyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dioxopyrrol-1-yl)ethyl propanoate?
The IUPAC name of 2-(2,5-dioxopyrrol-1-yl)ethyl propanoate (CID 58288592) is 2-(2,5-dioxopyrrol-1-yl)ethyl propanoate.
What is the SMILES notation for 2-(2,5-dioxopyrrol-1-yl)ethyl propanoate?
The canonical SMILES for 2-(2,5-dioxopyrrol-1-yl)ethyl propanoate is CCC(=O)OCCN1C(=O)C=CC1=O.
What is the InChIKey of 2-(2,5-dioxopyrrol-1-yl)ethyl propanoate?
The InChIKey is QREJQBFQTZRRJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO4/c1-2-9(13)14-6-5-10-7(11)3-4-8(10)12/h3-4H,2,5-6H2,1H3.
What are the key properties of 2-(2,5-dioxopyrrol-1-yl)ethyl propanoate?
2-(2,5-dioxopyrrol-1-yl)ethyl propanoate has a molecular weight of 197.19 g/mol, XLogP of -0.14, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dioxopyrrol-1-yl)ethyl propanoate is sourced from PubChem (CID 58288592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).