C30H61N3 — CID 58288657
1,2,2,6,6-pentamethyl-N-[7-(1,2,2,6,6-pentamethylpiperidin-4-yl)heptyl]-N-propan-2-ylpiperidin-4-amine (PubChem CID 58288657) has the molecular formula C30H61N3 and a molecular weight of 463.84 g/mol. Its IUPAC name is 1,2,2,6,6-pentamethyl-N-[7-(1,2,2,6,6-pentamethylpiperidin-4-yl)heptyl]-N-propan-2-ylpiperidin-4-amine.
| Compound Name | 1,2,2,6,6-pentamethyl-N-[7-(1,2,2,6,6-pentamethylpiperidin-4-yl)heptyl]-N-propan-2-ylpiperidin-4-amine |
|---|---|
| PubChem CID | 58288657 |
| Molecular Formula | C30H61N3 |
| Molecular Weight | 463.84 g/mol |
| Exact Mass | 463.49 |
| IUPAC Name | 1,2,2,6,6-pentamethyl-N-[7-(1,2,2,6,6-pentamethylpiperidin-4-yl)heptyl]-N-propan-2-ylpiperidin-4-amine |
| SMILES | CC(C)N(CCCCCCCC1CC(C)(C)N(C)C(C)(C)C1)C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C30H61N3/c1-24(2)33(26-22-29(7,8)32(12)30(9,10)23-26)19-17-15-13-14-16-18-25-20-27(3,4)31(11)28(5,6)21-25/h24-26H,13-23H2,1-12H3 |
| InChIKey | ZYNSREDAIZHOTR-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.84 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|