About 2-oxoethyl 4-methylbenzoate
2-oxoethyl 4-methylbenzoate (PubChem CID 58288903) has the molecular formula C10H10O3
and a molecular weight of 178.19 g/mol. Its IUPAC name is 2-oxoethyl 4-methylbenzoate.
Molecular Properties
| Compound Name | 2-oxoethyl 4-methylbenzoate |
| PubChem CID | 58288903 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 2-oxoethyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC=O)cc1 |
| InChI | InChI=1S/C10H10O3/c1-8-2-4-9(5-3-8)10(12)13-7-6-11/h2-6H,7H2,1H3 |
| InChIKey | GSPDCTBCGMHIGG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-oxoethyl 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxoethyl 4-methylbenzoate?
The IUPAC name of 2-oxoethyl 4-methylbenzoate (CID 58288903) is 2-oxoethyl 4-methylbenzoate.
What is the SMILES notation for 2-oxoethyl 4-methylbenzoate?
The canonical SMILES for 2-oxoethyl 4-methylbenzoate is Cc1ccc(C(=O)OCC=O)cc1.
What is the InChIKey of 2-oxoethyl 4-methylbenzoate?
The InChIKey is GSPDCTBCGMHIGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3/c1-8-2-4-9(5-3-8)10(12)13-7-6-11/h2-6H,7H2,1H3.
What are the key properties of 2-oxoethyl 4-methylbenzoate?
2-oxoethyl 4-methylbenzoate has a molecular weight of 178.19 g/mol, XLogP of 1.35, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxoethyl 4-methylbenzoate is sourced from PubChem (CID 58288903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).