C10H8N4S — CID 58289197
4,6-dimethyl-5-thia-2,8,10,13-tetrazatricyclo[7.4.0.03,7]trideca-1,3,6,8,10,12-hexaene (PubChem CID 58289197) has the molecular formula C10H8N4S and a molecular weight of 216.27 g/mol. Its IUPAC name is 4,6-dimethyl-5-thia-2,8,10,13-tetrazatricyclo[7.4.0.03,7]trideca-1,3,6,8,10,12-hexaene.
| Compound Name | 4,6-dimethyl-5-thia-2,8,10,13-tetrazatricyclo[7.4.0.03,7]trideca-1,3,6,8,10,12-hexaene |
|---|---|
| PubChem CID | 58289197 |
| Molecular Formula | C10H8N4S |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 4,6-dimethyl-5-thia-2,8,10,13-tetrazatricyclo[7.4.0.03,7]trideca-1,3,6,8,10,12-hexaene |
| SMILES | Cc1sc(C)c2nc3nccnc3nc12 |
| InChI | InChI=1S/C10H8N4S/c1-5-7-8(6(2)15-5)14-10-9(13-7)11-3-4-12-10/h3-4H,1-2H3 |
| InChIKey | SMHDWRSOQOWFOG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |