C19H34F2N2O4 — CID 58289260
2,2-difluoropropyl N-[3-[(butoxycarbonylamino)methyl]-3,5,5-trimethylcyclohexyl]carbamate (PubChem CID 58289260) has the molecular formula C19H34F2N2O4 and a molecular weight of 392.49 g/mol. Its IUPAC name is 2,2-difluoropropyl N-[3-[(butoxycarbonylamino)methyl]-3,5,5-trimethylcyclohexyl]carbamate.
| Compound Name | 2,2-difluoropropyl N-[3-[(butoxycarbonylamino)methyl]-3,5,5-trimethylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 58289260 |
| Molecular Formula | C19H34F2N2O4 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 2,2-difluoropropyl N-[3-[(butoxycarbonylamino)methyl]-3,5,5-trimethylcyclohexyl]carbamate |
| SMILES | CCCCOC(=O)NCC1(C)CC(NC(=O)OCC(C)(F)F)CC(C)(C)C1 |
| InChI | InChI=1S/C19H34F2N2O4/c1-6-7-8-26-15(24)22-12-18(4)10-14(9-17(2,3)11-18)23-16(25)27-13-19(5,20)21/h14H,6-13H2,1-5H3,(H,22,24)(H,23,25) |
| InChIKey | CSOVLWQNKHFWGR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|