C19H21ClN2O4S — CID 58289509
8-chloro-7-(2,2-dimethoxyethoxy)-2-(4-propan-2-yl-1,3-thiazol-2-yl)-1H-quinolin-4-one (PubChem CID 58289509) has the molecular formula C19H21ClN2O4S and a molecular weight of 408.91 g/mol. Its IUPAC name is 8-chloro-7-(2,2-dimethoxyethoxy)-2-(4-propan-2-yl-1,3-thiazol-2-yl)-1H-quinolin-4-one.
| Compound Name | 8-chloro-7-(2,2-dimethoxyethoxy)-2-(4-propan-2-yl-1,3-thiazol-2-yl)-1H-quinolin-4-one |
|---|---|
| PubChem CID | 58289509 |
| Molecular Formula | C19H21ClN2O4S |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 8-chloro-7-(2,2-dimethoxyethoxy)-2-(4-propan-2-yl-1,3-thiazol-2-yl)-1H-quinolin-4-one |
| SMILES | COC(COc1ccc2c(=O)cc(-c3nc(C(C)C)cs3)[nH]c2c1Cl)OC |
| InChI | InChI=1S/C19H21ClN2O4S/c1-10(2)13-9-27-19(22-13)12-7-14(23)11-5-6-15(17(20)18(11)21-12)26-8-16(24-3)25-4/h5-7,9-10,16H,8H2,1-4H3,(H,21,23) |
| InChIKey | LFXUMHDZGXUQKN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|