C16H27NO7 — CID 58289513
1-O-tert-butyl 2-O-methyl (2S,4R,5R)-4-hydroxy-5-(4-methoxy-4-oxobutyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 58289513) has the molecular formula C16H27NO7 and a molecular weight of 345.39 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4R,5R)-4-hydroxy-5-(4-methoxy-4-oxobutyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4R,5R)-4-hydroxy-5-(4-methoxy-4-oxobutyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 58289513 |
| Molecular Formula | C16H27NO7 |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4R,5R)-4-hydroxy-5-(4-methoxy-4-oxobutyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)CCC[C@@H]1[C@H](O)C[C@@H](C(=O)OC)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H27NO7/c1-16(2,3)24-15(21)17-10(7-6-8-13(19)22-4)12(18)9-11(17)14(20)23-5/h10-12,18H,6-9H2,1-5H3/t10-,11+,12-/m1/s1 |
| InChIKey | LKXVTLMFWNEESH-GRYCIOLGSA-N |
| XLogP | 1.24 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|