C20H33NO6 — CID 58289547
1-O-tert-butyl 2-O-methyl (2S,4R,5R)-5-[(E)-3-methoxycarbonyl-4-methylpent-2-enyl]-4-methylpyrrolidine-1,2-dicarboxylate (PubChem CID 58289547) has the molecular formula C20H33NO6 and a molecular weight of 383.49 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4R,5R)-5-[(E)-3-methoxycarbonyl-4-methylpent-2-enyl]-4-methylpyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4R,5R)-5-[(E)-3-methoxycarbonyl-4-methylpent-2-enyl]-4-methylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 58289547 |
| Molecular Formula | C20H33NO6 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4R,5R)-5-[(E)-3-methoxycarbonyl-4-methylpent-2-enyl]-4-methylpyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)/C(=C/C[C@@H]1[C@H](C)C[C@@H](C(=O)OC)N1C(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C20H33NO6/c1-12(2)14(17(22)25-7)9-10-15-13(3)11-16(18(23)26-8)21(15)19(24)27-20(4,5)6/h9,12-13,15-16H,10-11H2,1-8H3/b14-9+/t13-,15-,16+/m1/s1 |
| InChIKey | DBVOWBDTQOHOHS-NHGHTOHCSA-N |
| XLogP | 3.32 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|