C11H16N2 — CID 58289987
(2R)-2-N,2-N-dimethyl-2,3-dihydro-1H-indene-2,5-diamine (PubChem CID 58289987) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is (2R)-2-N,2-N-dimethyl-2,3-dihydro-1H-indene-2,5-diamine.
| Compound Name | (2R)-2-N,2-N-dimethyl-2,3-dihydro-1H-indene-2,5-diamine |
|---|---|
| PubChem CID | 58289987 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | (2R)-2-N,2-N-dimethyl-2,3-dihydro-1H-indene-2,5-diamine |
| SMILES | CN(C)[C@@H]1Cc2ccc(N)cc2C1 |
| InChI | InChI=1S/C11H16N2/c1-13(2)11-6-8-3-4-10(12)5-9(8)7-11/h3-5,11H,6-7,12H2,1-2H3/t11-/m1/s1 |
| InChIKey | SJZKTTYDLPTPPR-LLVKDONJSA-N |
| XLogP | 1.30 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|