C24H32N2O8 — CID 58290833
(2,5-dioxopyrrolidin-1-yl) 6-[3-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]propanoyloxy]hexanoate (PubChem CID 58290833) has the molecular formula C24H32N2O8 and a molecular weight of 476.53 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[3-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]propanoyloxy]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[3-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]propanoyloxy]hexanoate |
|---|---|
| PubChem CID | 58290833 |
| Molecular Formula | C24H32N2O8 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[3-[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexyl]propanoyloxy]hexanoate |
| SMILES | O=C(CCC1CCC(CN2C(=O)C=CC2=O)CC1)OCCCCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C24H32N2O8/c27-19-10-11-20(28)25(19)16-18-7-5-17(6-8-18)9-14-23(31)33-15-3-1-2-4-24(32)34-26-21(29)12-13-22(26)30/h10-11,17-18H,1-9,12-16H2 |
| InChIKey | BHERDDKKKHVHTQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|